|
Λεπτομέρειες:
|
| Όνομα προϊόντος: | 2-Διφαινυλοφωσφινοβενζαλδεΰδη | CAS: | 50777-76-9 |
|---|---|---|---|
| EINECS: | / | Σημείο τήξης: | 112-115 °C (lit.) |
| Θερμοκρασία αποθήκευσης.: | Κρατήστε στη σκοτεινή θέση, που σφραγίζεται στην ξηρά, θερμοκρασία δωματίου | Μορφή: | κρυσταλλική σκόνη |
| χρώμα: | Κίτρινος | ||
| Επισημαίνω: | 2-Diphenylphosphinobenzaldehyde biochemical reagent,CAS 50777-76-9 chemical compound,Diphenylphosphinobenzaldehyde industrial fine chemical |
||
CAS 50777-76-9 2-Diphenylphosphinobenzaldehyde
| 2-Diphenylphosphinobenzaldehyde Basic information |
| Product Name: | 2-Diphenylphosphinobenzaldehyde |
| Synonyms: | Diphenylphosphinobenzaldehyde;(2-Formylphenyl)diphenylphosphine;o-(Diphenylphosphino)benzaldehyde;2-DiphenylphosphiNAbenzaldehyde;2- twophenylphosphinebenzaldehyde;2-(Diphenylphosphino)benzaldehyde, min. 97%;2-Diphenylphosphinobenzaldehyde(DPPBde);2-(DIPHENYLPHOSPHINO)BENZALDEHYDE |
| CAS: | 50777-76-9 |
| MF: | C19H15OP |
| MW: | 290.3 |
| EINECS: | |
| Product Categories: | Aldehydes;Building Blocks;C13-C60;Carbonyl Compounds;Catalysis and Inorganic Chemistry;Chemical Synthesis;Organic Building Blocks;Phosphine Ligands;Phosphorus Compounds;Catalysis and Inorganic Chemistry;Phosphine Ligands;Phosphorus Compounds;phosphine ligand |
| Mol File: | 50777-76-9.mol |
| 2-Diphenylphosphinobenzaldehyde Chemical Properties |
| Melting point | 112-115 °C(lit.) |
| Boiling point | 417.4±28.0 °C(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| color | Yellow |
| λmax | 376nm(CH2Cl2)(lit.) |
| InChI | InChI=1S/C19H15OP/c20-15-16-9-7-8-14-19(16)21(17-10-3-1-4-11-17)18-12-5-2-6-13-18/h1-15H |
| InChIKey | DRCPJRZHAJMWOU-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=CC=C1P(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference | 50777-76-9(CAS DataBase Reference) |
![]()
Υπεύθυνος Επικοινωνίας: Maggie Ma
Τηλ.:: +0086 188 7414 9531